5-ethylbarbituric acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

5-ethylbarbiturate; 5-ethylbarbituric acid; 5-ethyl-1,3-diazinane-2,4,6-trione
Links:🕷 ChemSpider, 📖 PubMed
Formula:C6H8N2O3; 156.14 g/mol
InChiKey:FMTLDVACNZDTQL-UHFFFAOYSA-N
SMILES:CCC1C(=O)NC(=O)NC1=O
Molecular structure of 5-ethylbarbituric acid
Melting point:191 °C
Log10 partition octanol / water:-0.35

Isomers

1,3-dimethylbarbituric acid
Molecular structure of 1,3-dimethylbarbituric acid
5,5-dimethylbarbituric acid
Molecular structure of 5,5-dimethylbarbituric acid
ethyl 2-aminooxazole-4-carboxylate
Molecular structure of ethyl 2-aminooxazole-4-carboxylate
5-ethylbarbituric acid
Molecular structure of 5-ethylbarbituric acid
ethyl diazoacetoacetate
Molecular structure of ethyl diazoacetoacetate
methyl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate
Molecular structure of methyl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate
  ::